| Record Information |
|---|
| HMDB Status | detected |
|---|
| Creation Date | 2024-02-21 14:37:50 UTC |
|---|
| Update Date | 2025-03-25 00:45:42 UTC |
|---|
| HMDB ID | HMDB0244280 |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02150764 |
|---|
| Name | N(4)-Acetylsulfamethazine |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H16N4O3S |
|---|
| Molecular Mass | 320.0943 |
|---|
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Nc2nc(C)cc(C)n2)cc1 |
|---|
| InChI Key | LJKAKWDUZRJNPJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonamides |
|---|
| Direct Parent | benzenesulfonamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetamidesacetanilidesaminosulfonyl compoundsazacyclic compoundsbenzenesulfonyl compoundscarbonyl compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesn-acetylarylaminesorganic oxidesorganopnictogen compoundsorganosulfonamidespyrimidines and pyrimidine derivativessecondary carboxylic acid amides |
|---|
| Substituents | organosulfonic acid or derivativescarbonyl groupn-acetylarylaminearomatic heteromonocyclic compoundn-arylamideorganosulfur compoundcarboxylic acid derivativepyrimidineorganosulfonic acid amideorganic oxideorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundacetamidebenzenesulfonyl groupbenzenesulfonamideazacycleaminosulfonyl compoundacetanilideheteroaromatic compoundcarboxamide groupanilidesecondary carboxylic acid amidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativeshydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
