| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:37:51 UTC |
|---|
| Update Date | 2025-03-25 00:45:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02150780 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H8O6S |
|---|
| Molecular Mass | 232.0042 |
|---|
| SMILES | O=C(O)CC1=C(C(=O)O)C(C(=O)O)CS1 |
|---|
| InChI Key | SUAQVHQQQARXFA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tricarboxylic acids and derivatives |
|---|
| Direct Parent | tricarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidsdihydrothiopheneshydrocarbon derivativesorganic oxidesthioenol ethersvinylogous thioesters |
|---|
| Substituents | vinylogous thioestercarbonyl groupcarboxylic acid2,3-dihydrothiophenetricarboxylic acid or derivativesorganic oxidethioenoletherorganic oxygen compoundaliphatic heteromonocyclic compoundhydrocarbon derivativeorganoheterocyclic compoundorganooxygen compound |
|---|
