| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:37:51 UTC |
|---|
| Update Date | 2025-03-25 00:45:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02150803 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H24O3 |
|---|
| Molecular Mass | 300.1725 |
|---|
| SMILES | COc1ccc(C=CC(=O)OC2CC3CC(C2)C3(C)C)cc1 |
|---|
| InChI Key | MDYVLPIFYJBQCW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | cinnamic acids and derivatives |
|---|
| Subclass | cinnamic acids and derivatives |
|---|
| Direct Parent | cinnamic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesaromatic monoterpenoidsbicyclic monoterpenoidscarbonyl compoundsenoate estersfatty acid estershydrocarbon derivativesmethoxybenzenesmonocarboxylic acids and derivativesorganic oxidesphenoxy compounds |
|---|
| Substituents | fatty acylmonoterpenoidphenol ethermonocyclic benzene moietycarbonyl groupetheralkyl aryl ethercarboxylic acid derivativealpha,beta-unsaturated carboxylic estercinnamic acid or derivativesorganic oxidenopinane monoterpenoidenoate esteraromatic homopolycyclic compoundmethoxybenzenefatty acid estermonocarboxylic acid or derivativesorganic oxygen compoundanisolecarboxylic acid esterhydrocarbon derivativebicyclic monoterpenoidbenzenoidphenoxy compoundorganooxygen compoundaromatic monoterpenoid |
|---|
