| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:37:52 UTC |
|---|
| Update Date | 2025-03-25 00:45:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02150823 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H20N6O2 |
|---|
| Molecular Mass | 316.1648 |
|---|
| SMILES | CC(=O)NC(c1cnc2nc(N)[nH]c(=O)c2n1)C1CCCCC1 |
|---|
| InChI Key | LEZYNAABXKQIOW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | pterins and derivatives |
|---|
| Direct Parent | pterins and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetamidesamino acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativeslactamsorganic oxidesorganopnictogen compoundsprimary aminespyrazinespyrimidonessecondary carboxylic acid amides |
|---|
| Substituents | carbonyl grouplactamamino acid or derivativespyrimidonecarboxylic acid derivativepyrimidineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundacetamidepterinazacycleheteroaromatic compoundcarboxamide groupsecondary carboxylic acid amideorganic oxygen compoundpyrazinehydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
