| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:37:57 UTC |
|---|
| Update Date | 2025-03-25 00:45:45 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02151024 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H20O2 |
|---|
| Molecular Mass | 304.1463 |
|---|
| SMILES | CC(C(=O)O)c1ccc(C(C)c2ccc3ccccc3c2)cc1 |
|---|
| InChI Key | BSAYXLXUCMVWCD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | phenylpropanoic acids |
|---|
| Subclass | phenylpropanoic acids |
|---|
| Direct Parent | phenylpropanoic acids |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | aromatic monoterpenoidsbenzene and substituted derivativesbicyclic monoterpenoidscarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesnaphthalenesorganic oxides |
|---|
| Substituents | monoterpenoidmonocyclic benzene moietycarbonyl groupcarboxylic acidaromatic homopolycyclic compoundp-cymenecarboxylic acid derivativeorganic oxidemonocarboxylic acid or derivativesnaphthaleneorganic oxygen compound2-phenylpropanoic-acidhydrocarbon derivativebicyclic monoterpenoidbenzenoidorganooxygen compoundaromatic monoterpenoid |
|---|
