| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:00 UTC |
|---|
| Update Date | 2025-03-25 00:45:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02151120 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H14O5 |
|---|
| Molecular Mass | 274.0841 |
|---|
| SMILES | Cc1oc2c(c1C)C(=O)CC(c1ccc(O)c(O)c1)O2 |
|---|
| InChI Key | ZOCVQFNGZYVOQC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | furopyrans |
|---|
| Subclass | furopyrans |
|---|
| Direct Parent | furopyrans |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl aryl ethersaryl alkyl ketonesbenzene and substituted derivativesfuroic acid and derivativesheteroaromatic compoundshydrocarbon derivativesorganic oxidesoxacyclic compoundspyrans |
|---|
| Substituents | furanmonocyclic benzene moietyfuroic acid or derivativesetheraryl alkyl ketoneheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidfuropyran1-hydroxy-4-unsubstituted benzenoidalkyl aryl etherketoneoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyranphenolhydrocarbon derivativebenzenoidorganooxygen compoundaryl ketone |
|---|
