| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:00 UTC |
|---|
| Update Date | 2025-03-25 00:45:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02151121 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H12O6 |
|---|
| Molecular Mass | 288.0634 |
|---|
| SMILES | Cc1oc2c(c(=O)c1O)C(=O)CC(c1ccc(O)cc1)O2 |
|---|
| InChI Key | SOTVJQNAVABKHE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | aryl alkyl ketones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativesorganic oxidesoxacyclic compoundspyranones and derivativesvinylogous esters |
|---|
| Substituents | monocyclic benzene moietyetheraryl alkyl ketonevinylogous esterheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidalkyl aryl etheroxacycleorganic oxidearomatic heteropolycyclic compoundpyranpyranonephenolhydrocarbon derivativebenzenoidorganoheterocyclic compound |
|---|
