| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:02 UTC |
|---|
| Update Date | 2025-03-25 00:45:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02151202 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H14N2O2S |
|---|
| Molecular Mass | 262.0776 |
|---|
| SMILES | Cc1ncsc1COc1ccc(CC(N)=O)cc1 |
|---|
| InChI Key | KOXCMAIZVGLADA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylacetamides |
|---|
| Direct Parent | phenylacetamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 4,5-disubstituted thiazolesalkyl aryl ethersazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenol ethersphenoxy compoundsprimary carboxylic acid amides |
|---|
| Substituents | primary carboxylic acid amidephenol ethercarbonyl groupetheraromatic heteromonocyclic compoundalkyl aryl ethercarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundphenylacetamideorganoheterocyclic compoundazoleazacycleheteroaromatic compoundcarboxamide group4,5-disubstituted 1,3-thiazoleorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundthiazoleorganooxygen compound |
|---|
