| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:05 UTC |
|---|
| Update Date | 2025-03-25 00:45:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02151338 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H5F4N |
|---|
| Molecular Mass | 215.0358 |
|---|
| SMILES | Fc1ccc2nc(C(F)(F)F)ccc2c1 |
|---|
| InChI Key | GDUZDLJAUQBFFM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | quinolines and derivatives |
|---|
| Subclass | haloquinolines |
|---|
| Direct Parent | haloquinolines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesalkyl fluoridesaryl fluoridesazacyclic compoundsbenzenoidsheteroaromatic compoundshydrocarbon derivativesorganofluoridesorganonitrogen compoundsorganopnictogen compoundspolyhalopyridinespyridines and derivatives |
|---|
| Substituents | aryl fluorideazacyclepolyhalopyridinealkyl fluorideorganofluorideheteroaromatic compoundorganohalogen compoundaryl halidehaloquinolinepyridinearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundalkyl halidehydrocarbon derivativebenzenoid2-halopyridineorganic nitrogen compound |
|---|
