| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:06 UTC |
|---|
| Update Date | 2025-03-25 00:45:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02151355 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H16N4O4 |
|---|
| Molecular Mass | 304.1172 |
|---|
| SMILES | Cn1c(N)c(NC(=O)Cc2ccc(O)cc2)c(=O)n(C)c1=O |
|---|
| InChI Key | PUYNYZWJHCLBBO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylacetamides |
|---|
| Direct Parent | phenylacetamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsamino acids and derivativesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativeslactamsn-arylamidesorganic oxidesorganopnictogen compoundsprimary aminespyrimidonessecondary carboxylic acid amidesureasvinylogous amides |
|---|
| Substituents | carbonyl grouplactamaromatic heteromonocyclic compoundamino acid or derivatives1-hydroxy-2-unsubstituted benzenoidpyrimidonen-arylamidecarboxylic acid derivativepyrimidineureaorganic oxideorganonitrogen compoundorganopnictogen compoundphenylacetamideorganoheterocyclic compoundvinylogous amidecarbonic acid derivativeazacycleheteroaromatic compoundcarboxamide groupsecondary carboxylic acid amideorganic oxygen compoundphenolhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
