| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:07 UTC |
|---|
| Update Date | 2025-03-25 00:45:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02151391 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H16N4O5 |
|---|
| Molecular Mass | 284.1121 |
|---|
| SMILES | Cn1c(=O)[nH]c(N2CCOCC2)c(NC(=O)CO)c1=O |
|---|
| InChI Key | XZLSFWWIRHGZME-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic nitrogen compounds |
|---|
| Class | organonitrogen compounds |
|---|
| Subclass | n-arylamides |
|---|
| Direct Parent | n-arylamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsaminopyrimidines and derivativesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkyl ethersdialkylarylaminesheteroaromatic compoundshydrocarbon derivativeslactamsmorpholinesorganic carbonic acids and derivativesorganic oxidesorganopnictogen compoundsoxacyclic compoundspyrimidonessecondary carboxylic acid amidesvinylogous amides |
|---|
| Substituents | carbonyl groupetherlactamaromatic heteromonocyclic compoundpyrimidonen-arylamidecarboxylic acid derivativedialkyl etherpyrimidineorganic oxideorganopnictogen compounddialkylarylamineorganoheterocyclic compoundalcoholvinylogous amidecarbonic acid derivativeazacycleheteroaromatic compoundcarboxamide groupoxazinaneaminopyrimidineoxacyclesecondary carboxylic acid amidemorpholineorganic oxygen compoundhydrocarbon derivativeorganooxygen compound |
|---|
