| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:08 UTC |
|---|
| Update Date | 2025-03-25 00:45:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02151459 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C22H23FN2O2 |
|---|
| Molecular Mass | 366.1744 |
|---|
| SMILES | N#Cc1ccc2c(c1)COC2(CCCNCC1(O)CC1)c1ccc(F)cc1 |
|---|
| InChI Key | PWOIIKSYCXBPSF-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylbutylamines |
|---|
| Direct Parent | phenylbutylamines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aryl fluoridescyclic alcohols and derivativesdialkyl ethersdialkylaminesfluorobenzeneshydrocarbon derivativesisocoumaransnitrilesorganofluoridesorganopnictogen compoundsoxacyclic compoundstertiary alcohols |
|---|
| Substituents | aryl fluorideethernitrileorganohalogen compounddialkyl etherfluorobenzenephenylbutylamineisocoumaranaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundcyclopropanolcarbonitrileorganoheterocyclic compoundalcoholsecondary aliphatic amineorganofluoridesecondary aminearyl halideoxacycletertiary alcoholorganic oxygen compoundhydrocarbon derivativeorganic nitrogen compoundhalobenzeneorganooxygen compoundamine |
|---|