| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:09 UTC |
|---|
| Update Date | 2025-03-25 00:45:49 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02151468 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H18N3O5P |
|---|
| Molecular Mass | 303.0984 |
|---|
| SMILES | C=Cc1ncn(C2CC(O)C(COP(=O)(O)O)C2)c1N |
|---|
| InChI Key | XVYHBDCAAIGONH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | monoalkyl phosphates |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscyclic alcohols and derivativescyclopentanolsheteroaromatic compoundshydrocarbon derivativesimidazolesn-substituted imidazolesorganic oxidesorganopnictogen compoundsprimary amines |
|---|
| Substituents | aromatic heteromonocyclic compoundorganic oxideimidazoleorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundazolen-substituted imidazolealcoholazacycleheteroaromatic compoundcyclic alcoholcyclopentanolorganic oxygen compoundmonoalkyl phosphatesecondary alcoholhydrocarbon derivativeprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
