| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:14 UTC |
|---|
| Update Date | 2025-03-25 00:45:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02151663 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H5ClF3N |
|---|
| Molecular Mass | 231.0063 |
|---|
| SMILES | FC(F)(F)c1ccnc2ccc(Cl)cc12 |
|---|
| InChI Key | KVPFPVZYIZYOSS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | quinolines and derivatives |
|---|
| Subclass | haloquinolines |
|---|
| Direct Parent | haloquinolines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesalkyl fluoridesaryl chloridesazacyclic compoundsbenzenoidsheteroaromatic compoundshydrocarbon derivativesorganochloridesorganofluoridesorganonitrogen compoundsorganopnictogen compoundspolyhalopyridinespyridines and derivatives |
|---|
| Substituents | aryl chlorideazacyclepolyhalopyridinealkyl fluorideorganofluorideorganochlorideheteroaromatic compoundorganohalogen compoundaryl halidehaloquinolinepyridinearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundalkyl halidehydrocarbon derivativebenzenoid2-halopyridineorganic nitrogen compound |
|---|
