| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:14 UTC |
|---|
| Update Date | 2025-03-25 00:45:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02151666 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | CH7N3O6P2 |
|---|
| Molecular Mass | 218.981 |
|---|
| SMILES | N=C(N)N(P(=O)(O)O)P(=O)(O)O |
|---|
| InChI Key | UCELSSPRQWXUJY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | organic phosphoric acids and derivatives |
|---|
| Direct Parent | organic phosphoric acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carboximidamidesguanidineshydrocarbon derivativesiminesorganic oxidesorganopnictogen compounds |
|---|
| Substituents | aliphatic acyclic compoundorganic oxideorganic oxygen compoundguanidineimineorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativecarboximidamideorganic nitrogen compoundorganic phosphoric acid derivative |
|---|
