| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:14 UTC |
|---|
| Update Date | 2025-03-25 00:45:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02151668 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C12H7F3N2 |
|---|
| Molecular Mass | 236.0561 |
|---|
| SMILES | FC(F)(F)c1ccc2[nH]c3cnccc3c2c1 |
|---|
| InChI Key | DTIBSUIWQIHXOH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | indoles and derivatives |
|---|
| Subclass | pyridoindoles |
|---|
| Direct Parent | beta carbolines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl fluoridesazacyclic compoundsbenzenoidsheteroaromatic compoundshydrocarbon derivativesindolesorganofluoridesorganonitrogen compoundsorganopnictogen compoundspolyhalopyridinespyridines and derivativespyrroles |
|---|
| Substituents | azacycleindolealkyl fluorideorganofluoridepolyhalopyridineheteroaromatic compoundorganohalogen compoundpyridinearomatic heteropolycyclic compoundpyrroleorganonitrogen compoundorganopnictogen compoundalkyl halidebeta-carbolinehydrocarbon derivativebenzenoidorganic nitrogen compound |
|---|
