| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:14 UTC |
|---|
| Update Date | 2025-03-25 00:45:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02151671 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H11F3N2 |
|---|
| Molecular Mass | 216.0874 |
|---|
| SMILES | FC(F)(F)c1cccc(C2CCNC2)n1 |
|---|
| InChI Key | VSBVFFHHDIMQNG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridines and derivatives |
|---|
| Subclass | halopyridines |
|---|
| Direct Parent | polyhalopyridines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesalkyl fluoridesazacyclic compoundsdialkylaminesheteroaromatic compoundshydrocarbon derivativesorganofluoridesorganopnictogen compoundspyridines and derivativespyrrolidines |
|---|
| Substituents | secondary aliphatic aminearomatic heteromonocyclic compoundazacyclealkyl fluorideorganofluoridepolyhalopyridineheteroaromatic compoundsecondary amineorganohalogen compoundorganonitrogen compoundorganopnictogen compoundalkyl halidehydrocarbon derivative2-halopyridineorganic nitrogen compoundpyrrolidineamine |
|---|
