| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:15 UTC |
|---|
| Update Date | 2025-03-25 00:45:51 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02151725 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H10N6O |
|---|
| Molecular Mass | 206.0916 |
|---|
| SMILES | N=C(N)NC(=N)NC(=O)c1cccnc1 |
|---|
| InChI Key | MSZISXCYZHNDRO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridines and derivatives |
|---|
| Subclass | pyridinecarboxylic acids and derivatives |
|---|
| Direct Parent | pyridinecarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbiguanidescarboximidamidescarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesiminesnicotinamidesorganic oxidesorganooxygen compoundsorganopnictogen compounds |
|---|
| Substituents | pyridine carboxylic acid or derivativesaromatic heteromonocyclic compoundazacycleguanidineiminenicotinamideheteroaromatic compoundcarboximidamidecarboxylic acid derivativeorganic oxideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundbiguanideorganooxygen compound |
|---|
