| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:21 UTC |
|---|
| Update Date | 2025-03-25 00:45:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02151942 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H12N2O3S |
|---|
| Molecular Mass | 312.0569 |
|---|
| SMILES | NC(C(=O)O)C(=O)C1=Nc2ccccc2Sc2ccccc21 |
|---|
| InChI Key | UFIUSERRICJWFH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | benzothiazepines |
|---|
| Subclass | dibenzothiazepines |
|---|
| Direct Parent | dibenzothiazepines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,3-dicarbonyl compoundsalpha amino acidsazacyclic compoundsbenzenoidsbeta-hydroxy ketonesbeta-keto acids and derivativescarboxylic acidsdiarylthioethershydrocarbon derivativesketiminesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundspropargyl-type 1,3-dipolar organic compounds |
|---|
| Substituents | beta-hydroxy ketoneketiminecarbonyl groupcarboxylic acidiminealpha-amino acid or derivativescarboxylic acid derivativearyl thioetherbeta-keto acidpropargyl-type 1,3-dipolar organic compoundketonedibenzothiazepineorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundalpha-amino acidorganopnictogen compounddiarylthioetherazacycleorganic 1,3-dipolar compoundmonocarboxylic acid or derivativesorganic oxygen compoundthioetherketo acidhydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compound1,3-dicarbonyl compoundorganooxygen compound |
|---|