| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:22 UTC |
|---|
| Update Date | 2025-03-25 00:45:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02152006 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C4H6NO8P |
|---|
| Molecular Mass | 226.9831 |
|---|
| SMILES | NC(C(=O)O)=C(OP(=O)(O)O)C(=O)O |
|---|
| InChI Key | KJIGKERXUOEHQL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidsdicarboxylic acids and derivativeshydrocarbon derivativesmonoalkylaminesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphosphate estersshort-chain hydroxy acids and derivativesunsaturated fatty acidsvinylogous amides |
|---|
| Substituents | fatty acylvinylogous amidealiphatic acyclic compoundcarbonyl groupcarboxylic acidshort-chain hydroxy acidfatty acidunsaturated fatty acidorganic oxideorganic oxygen compoundphosphoric acid esterorganonitrogen compoundalpha-amino aciddicarboxylic acid or derivativesorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganic phosphoric acid derivativeorganooxygen compound |
|---|
