| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:23 UTC |
|---|
| Update Date | 2025-03-25 00:45:54 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02152034 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H9I2NO5 |
|---|
| Molecular Mass | 476.857 |
|---|
| SMILES | NC(CC(=O)c1cc(I)c(O)c(I)c1O)C(=O)O |
|---|
| InChI Key | XYGUESQBQDYFFO-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbonyl compounds |
|---|
| Direct Parent | alkyl-phenylketones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsaryl alkyl ketonesaryl iodidesbenzoyl derivativesbutyrophenonescarboxylic acidsgamma-keto acids and derivativeshalophenolshydrocarbon derivativesiodobenzenesmonoalkylaminesmonocarboxylic acids and derivativeso-iodophenolsorganic oxidesorganoiodidesorganonitrogen compoundsorganopnictogen compoundsp-iodophenolsresorcinolsvinylogous acids |
|---|
| Substituents | monocyclic benzene moietycarboxylic acidaryl alkyl ketonebenzoylalpha-amino acid or derivativescarboxylic acid derivativeorganohalogen compoundiodobenzene4-iodophenolorganoiodideresorcinolorganic oxide4-halophenolorganonitrogen compoundalpha-amino acidorganopnictogen compound2-iodophenolaryl halidegamma-keto acidbutyrophenonearomatic homomonocyclic compound2-halophenolvinylogous acidmonocarboxylic acid or derivativesketo acidphenolhydrocarbon derivativebenzenoidprimary aliphatic aminearyl iodideorganic nitrogen compoundhalobenzenealkyl-phenylketone |
|---|