Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:38:25 UTC |
---|
Update Date | 2025-03-25 00:45:55 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02152120 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C18H24N2O10 |
---|
Molecular Mass | 428.1431 |
---|
SMILES | NC(COC1OC(C(=O)O)C(O)C(O)C1O)C(=O)NC(Cc1ccccc1)C(=O)O |
---|
InChI Key | AJCQXUBEIYCIOL-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic acids and derivatives |
---|
Class | carboxylic acids and derivatives |
---|
Subclass | amino acids, peptides, and analogues |
---|
Direct Parent | dipeptides |
---|
Geometric Descriptor | aromatic heteromonocyclic compounds |
---|
Alternative Parents | acetalsalpha amino acid amidesalpha amino acidsamphetamines and derivativesbenzene and substituted derivativesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesglucuronic acid derivativeshydrocarbon derivativesmonoalkylaminesmonosaccharidesn-acyl-alpha amino acidso-glucuronidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesphenylalanine and derivativesphenylpropanoic acidspyran carboxylic acidssecondary alcoholssecondary carboxylic acid amides |
---|
Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidglucuronic acid or derivativesaromatic heteromonocyclic compound3-phenylpropanoic-acido-glucuronidemonosaccharidealpha-amino acid or derivativespyran carboxylic acid1-o-glucuronidebeta-hydroxy acidsaccharideorganic oxideacetalorganonitrogen compoundalpha-amino acidorganopnictogen compoundoxaneorganoheterocyclic compoundamphetamine or derivativesn-acyl-alpha amino acid or derivativesalcoholpyran carboxylic acid or derivativesalpha-amino acid amiden-acyl-alpha-amino acidhydroxy acidcarboxamide groupalpha-dipeptideoxacyclesecondary carboxylic acid amidephenylalanine or derivativesorganic oxygen compoundpyransecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
---|