| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:26 UTC |
|---|
| Update Date | 2025-03-25 00:45:55 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02152126 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H13N2O6P |
|---|
| Molecular Mass | 264.0511 |
|---|
| SMILES | NC(COP(=O)(O)O)Cn1cccc1C(=O)O |
|---|
| InChI Key | NNTGOAQAOMALTL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic phosphoric acids and derivatives |
|---|
| Subclass | phosphate esters |
|---|
| Direct Parent | phosphoethanolamines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarboxylic acidsheteroaromatic compoundshydrocarbon derivativesmonoalkyl phosphatesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspyrrole 2-carboxylic acidspyrrole carboxylic acids and derivativessubstituted pyrroles |
|---|
| Substituents | carboxylic acidaromatic heteromonocyclic compoundsubstituted pyrrolecarboxylic acid derivativephosphoethanolamineorganic oxidepyrrole-2-carboxylic acidpyrrole-2-carboxylic acid or derivativesorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundazacycleheteroaromatic compoundmonocarboxylic acid or derivativesorganic oxygen compoundmonoalkyl phosphatepyrrolehydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundalkyl phosphateorganooxygen compound |
|---|