| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:30 UTC |
|---|
| Update Date | 2025-03-25 00:45:57 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02152303 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H16BrN2O2+ |
|---|
| Molecular Mass | 287.039 |
|---|
| SMILES | NC(CCCC[n+]1cccc(Br)c1)C(=O)O |
|---|
| InChI Key | XLGFNJLVKSPBAA-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aryl bromidesazacyclic compoundscarbonyl compoundscarboxylic acidshalogenated fatty acidsheteroaromatic compoundsheterocyclic fatty acidshydrocarbon derivativeshydroxypyridinesmedium-chain fatty acidsmonoalkylaminesmonocarboxylic acids and derivativesorganic cationsorganic oxidesorganobromidesorganonitrogen compoundsorganopnictogen compounds |
|---|
| Substituents | fatty acylcarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundheterocyclic fatty acidfatty acidorganohalogen compoundorganic oxideorganonitrogen compoundalpha-amino acidorganopnictogen compoundmedium-chain fatty acidorganic cationorganoheterocyclic compoundhalogenated fatty acidazacycleheteroaromatic compoundhydroxypyridinearyl halidemonocarboxylic acid or derivativespyridineorganic oxygen compoundorganobromidehydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundaryl bromideorganooxygen compound |
|---|