| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:33 UTC |
|---|
| Update Date | 2025-03-25 00:45:58 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02152416 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H13N3O4S2 |
|---|
| Molecular Mass | 291.0347 |
|---|
| SMILES | NC(CCSCC(=O)c1ccco1)=NS(N)(=O)=O |
|---|
| InChI Key | XQHMLZHSLXLFKJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | furans |
|---|
| Subclass | furoic acid and derivatives |
|---|
| Direct Parent | furoic acid and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | amidinesaryl alkyl ketonesdialkylthioethersheteroaromatic compoundshydrocarbon derivativesorganic oxidesorganic sulfuric acids and derivativesorganooxygen compoundsorganopnictogen compoundsoxacyclic compoundssulfenyl compounds |
|---|
| Substituents | furoic acid or derivativesorganic sulfuric acid or derivativesaryl alkyl ketonesulfenyl compoundaromatic heteromonocyclic compounddialkylthioetherheteroaromatic compoundamidineorganosulfur compoundketoneoxacycleorganic oxideorganic oxygen compoundthioetherorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compoundaryl ketone |
|---|
