| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:40 UTC |
|---|
| Update Date | 2025-03-25 00:46:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02152682 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H11N3O3 |
|---|
| Molecular Mass | 209.08 |
|---|
| SMILES | N=C(N)NOC(=O)Cc1ccc(O)cc1 |
|---|
| InChI Key | GFWUFCAIERMDCD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | 1-hydroxy-2-unsubstituted benzenoids |
|---|
| Direct Parent | 1-hydroxy-2-unsubstituted benzenoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | benzene and substituted derivativescarbonyl compoundscarboximidamidescarboxylic acid saltsguanidineshydrocarbon derivativesiminesmonocarboxylic acids and derivativesorganic oxidesorganic saltsorganopnictogen compounds |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupguanidineimine1-hydroxy-2-unsubstituted benzenoidcarboximidamidecarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic saltcarboxylic acid saltorganooxygen compound |
|---|
