| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:41 UTC |
|---|
| Update Date | 2025-03-25 00:46:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02152704 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H17ClN4O5 |
|---|
| Molecular Mass | 344.0887 |
|---|
| SMILES | N=C(NC(=O)Nc1ccc(Cl)cc1)NC1OC(CO)C(O)C1O |
|---|
| InChI Key | YCNJDOJKHDEBGQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | n-phenylureas |
|---|
| Direct Parent | n-phenylureas |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aryl chloridescarbonyl compoundscarboximidamideschlorobenzenesguanidineshydrocarbon derivativesiminesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganochloridesorganopnictogen compoundsoxacyclic compoundsprimary alcoholssecondary alcoholstetrahydrofurans |
|---|
| Substituents | carbonyl grouparomatic heteromonocyclic compoundguanidineimineorganochloridemonosaccharideorganohalogen compoundsaccharideorganic oxideorganonitrogen compoundorganopnictogen compoundprimary alcoholorganoheterocyclic compoundaryl chloridechlorobenzenealcoholcarbonic acid derivativetetrahydrofurancarboximidamidearyl halideoxacyclen-phenylureaorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|
