| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:41 UTC |
|---|
| Update Date | 2025-03-25 00:46:00 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02152718 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H16N4O3S |
|---|
| Molecular Mass | 284.0943 |
|---|
| SMILES | N=C(N)Nc1ccc(S(=O)CCC(N)C(=O)O)cc1 |
|---|
| InChI Key | CVDSPCOAULTAKW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboximidamidescarboxylic acidsfatty acylsguanidineshydrocarbon derivativesiminesmonoalkylaminesmonocarboxylic acids and derivativesorganic oxidesorganopnictogen compoundsphenyl sulfoxidessulfinyl compoundssulfoxidesthia fatty acids |
|---|
| Substituents | fatty acylmonocyclic benzene moietycarbonyl groupcarboxylic acidguanidineimineorganosulfur compoundorganic oxidephenyl sulfoxidesulfinyl compoundorganonitrogen compoundalpha-amino acidorganopnictogen compoundcarboximidamidearomatic homomonocyclic compoundmonocarboxylic acid or derivativesthia fatty acidorganic oxygen compoundsulfoxidehydrocarbon derivativebenzenoidprimary aliphatic amineorganic nitrogen compoundorganooxygen compound |
|---|