| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:41 UTC |
|---|
| Update Date | 2025-03-25 00:46:01 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02152729 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H13N3 |
|---|
| Molecular Mass | 211.1109 |
|---|
| SMILES | N=C(N)c1ccc(-c2ccc(N)cc2)cc1 |
|---|
| InChI Key | SXDJPMBYUGSJJL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzene and substituted derivatives |
|---|
| Direct Parent | benzene and substituted derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | amidinescarboximidamideshydrocarbon derivativesorganopnictogen compoundsprimary amines |
|---|
| Substituents | aromatic homomonocyclic compoundmonocyclic benzene moietyorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeamidinecarboximidamideprimary amineorganic nitrogen compoundamine |
|---|
