Record Information |
---|
HMDB Status | Not Available |
---|
Creation Date | 2024-02-21 14:38:43 UTC |
---|
Update Date | 2025-03-25 00:46:02 UTC |
---|
HMDB ID | Not Available |
---|
Metabolite Identification |
---|
DeepMet ID | DMID02152800 |
---|
Frequency | 0.5 |
---|
Structure | |
---|
Chemical Formula | C16H25ClN6O2 |
---|
Molecular Mass | 368.1728 |
---|
SMILES | N=C(NCCCCNCCCC(=O)O)NC(=N)Nc1ccc(Cl)cc1 |
---|
InChI Key | BPHOQGCMWKZQSW-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Kingdom | organic compounds |
---|
Superclass | organic nitrogen compounds |
---|
Class | organonitrogen compounds |
---|
Subclass | guanidines |
---|
Direct Parent | 1-arylbiguanides |
---|
Geometric Descriptor | aromatic homomonocyclic compounds |
---|
Alternative Parents | amino acidsaryl chloridescarbonyl compoundscarboximidamidescarboxylic acidschlorobenzenesdialkylaminesgamma amino acids and derivativeshydrocarbon derivativesiminesmonocarboxylic acids and derivativesorganic oxidesorganochloridesorganopnictogen compounds |
---|
Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidamino acid or derivativesamino acidgamma amino acid or derivativesimineorganochloridecarboxylic acid derivativeorganohalogen compoundorganic oxideorganopnictogen compound1-arylbiguanidearyl chloridechlorobenzenesecondary aliphatic aminecarboximidamidesecondary aminearyl halidearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundhydrocarbon derivativebenzenoidhalobenzeneorganooxygen compoundamine |
---|