| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:44 UTC |
|---|
| Update Date | 2025-03-25 00:46:02 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02152862 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C23H33N11O |
|---|
| Molecular Mass | 479.287 |
|---|
| SMILES | N=C(NCCCCCCNC(=N)NC(=N)Nc1ccc(C(N)=O)cc1)NC(=N)Nc1ccccc1 |
|---|
| InChI Key | ZPUKBCHDOZZJIG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | guanidinobenzoic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-arylbiguanidesbenzamidesbenzoyl derivativescarboximidamidescarboxylic acids and derivativeshydrocarbon derivativesiminesorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary carboxylic acid amides |
|---|
| Substituents | primary carboxylic acid amideguanidineiminebenzoylcarboximidamidecarboxamide groupcarboxylic acid derivativebenzamidearomatic homomonocyclic compoundorganic oxidearylbiguanideorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivative1-arylbiguanideguanidinobenzoic acid or derivativesorganic nitrogen compoundbiguanideorganooxygen compound |
|---|
