| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:46 UTC |
|---|
| Update Date | 2025-03-25 00:46:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02152912 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C6H13N2O8P |
|---|
| Molecular Mass | 272.041 |
|---|
| SMILES | NC(=O)NCC(=O)C(O)C(O)COP(=O)(O)O |
|---|
| InChI Key | IAQIIGMGOJDXOI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | pentose phosphates |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | 1,2-diolsacyloinsalpha-hydroxy ketonesbeta-hydroxy ketoneshydrocarbon derivativesmonoalkyl phosphatesmonosaccharidesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundssecondary alcohols |
|---|
| Substituents | beta-hydroxy ketonealiphatic acyclic compoundcarbonyl grouppentose-5-phosphatealpha-hydroxy ketoneketoneorganic oxideorganonitrogen compoundorganopnictogen compound1,2-diolalcoholcarbonic acid derivativephosphoric acid estermonoalkyl phosphateacyloinsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
|---|
