| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:46 UTC |
|---|
| Update Date | 2025-03-25 00:46:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02152914 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H19BrN2 |
|---|
| Molecular Mass | 330.0732 |
|---|
| SMILES | C=CCNCCC(c1ccc(Br)cc1)c1ccccn1 |
|---|
| InChI Key | SOMNAPPRWONPBU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | halobenzenes |
|---|
| Direct Parent | bromobenzenes |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesaryl bromidesazacyclic compoundsdialkylaminesheteroaromatic compoundshydrocarbon derivativesorganobromidesorganopnictogen compoundspyridines and derivatives |
|---|
| Substituents | secondary aliphatic aminearomatic heteromonocyclic compoundazacycleheteroaromatic compoundbromobenzenesecondary amineorganohalogen compoundaryl halidepyridineorganonitrogen compoundorganobromideorganopnictogen compoundhydrocarbon derivative2-halopyridineorganic nitrogen compoundaryl bromideorganoheterocyclic compoundamine |
|---|
