| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:47 UTC |
|---|
| Update Date | 2025-03-25 00:46:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02152949 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H21NO8 |
|---|
| Molecular Mass | 343.1267 |
|---|
| SMILES | NC(=O)Cc1ccc(OC2OC(C(O)CO)C(O)C(O)C2O)cc1 |
|---|
| InChI Key | DHDYHDVWCLFZBP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenylacetamides |
|---|
| Direct Parent | phenylacetamides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesphenol ethersphenoxy compoundsprimary alcoholsprimary carboxylic acid amidessecondary alcohols |
|---|
| Substituents | primary carboxylic acid amidephenol ethercarbonyl grouparomatic heteromonocyclic compoundmonosaccharidecarboxylic acid derivativesaccharideorganic oxideacetalorganonitrogen compoundorganopnictogen compoundoxaneprimary alcoholphenylacetamideorganoheterocyclic compoundalcoholcarboxamide groupoxacycleorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
