| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:47 UTC |
|---|
| Update Date | 2025-03-25 00:46:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02152951 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H10BrNO4 |
|---|
| Molecular Mass | 286.9793 |
|---|
| SMILES | NC(=O)Cc1ccc(OCC(=O)O)c(Br)c1 |
|---|
| InChI Key | LEOUZFQXOBBZQM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenoxyacetic acid derivatives |
|---|
| Direct Parent | phenoxyacetic acid derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersaryl bromidesbromobenzenescarbonyl compoundscarboxylic acidshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesorganobromidesorganonitrogen compoundsorganopnictogen compoundsphenol ethersphenoxy compoundsphenylacetamidesprimary carboxylic acid amides |
|---|
| Substituents | primary carboxylic acid amidephenol etherphenoxyacetatecarbonyl groupethercarboxylic acidalkyl aryl ethercarboxylic acid derivativeorganohalogen compoundorganic oxideorganonitrogen compoundorganopnictogen compoundphenylacetamidebromobenzenecarboxamide grouparyl halidearomatic homomonocyclic compoundmonocarboxylic acid or derivativesorganic oxygen compoundorganobromidehydrocarbon derivativeorganic nitrogen compoundhalobenzenephenoxy compoundaryl bromideorganooxygen compound |
|---|
