| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:48 UTC |
|---|
| Update Date | 2025-03-25 00:46:03 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02153003 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H10N2OS |
|---|
| Molecular Mass | 242.0514 |
|---|
| SMILES | NC(=O)c1cccc2c1Sc1ccccc1N2 |
|---|
| InChI Key | SKTMYHVQIFWPQP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | benzothiazines |
|---|
| Subclass | phenothiazines |
|---|
| Direct Parent | phenothiazines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,4-thiazinesamino acids and derivativesazacyclic compoundsbenzenoidscarboxylic acids and derivativesdiarylthioethershydrocarbon derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary carboxylic acid amidessecondary aminesvinylogous thioesters |
|---|
| Substituents | primary carboxylic acid amideamino acid or derivativescarboxylic acid derivativearyl thioetherorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compounddiarylthioetherphenothiazinevinylogous thioesterpara-thiazineazacyclesecondary aminecarboxamide grouporganic oxygen compoundthioetherhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compoundamine |
|---|
