| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:49 UTC |
|---|
| Update Date | 2025-03-25 00:46:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02153051 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H4Cl3NO2 |
|---|
| Molecular Mass | 238.9308 |
|---|
| SMILES | NC(=O)c1cc(Cl)c(Cl)c(Cl)c1O |
|---|
| InChI Key | YDENATMXBBSTDL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | salicylamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 3-halobenzoic acids and derivatives4-halobenzoic acids and derivativesaryl chloridesbenzamidesbenzoyl derivativescarboxylic acids and derivativeschlorobenzeneshalophenolshydrocarbon derivativesm-chlorophenolso-chlorophenolsorganic oxidesorganochloridesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundsp-chlorophenolsprimary carboxylic acid amidesvinylogous acids |
|---|
| Substituents | primary carboxylic acid amide3-halobenzoic acid or derivativesorganochloridebenzoylcarboxylic acid derivativeorganohalogen compoundbenzamideorganic oxide4-halophenolorganonitrogen compoundorganopnictogen compoundaryl chloride2-chlorophenolchlorobenzene3-halophenol3-chlorophenol4-chlorophenolhalobenzoic acid or derivativescarboxamide groupsalicylamidearyl halide4-halobenzoic acid or derivativesaromatic homomonocyclic compound2-halophenolvinylogous acidorganic oxygen compoundphenolhydrocarbon derivativeorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|
