| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:49 UTC |
|---|
| Update Date | 2025-03-25 00:46:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02153057 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H7I4NO3 |
|---|
| Molecular Mass | 732.6605 |
|---|
| SMILES | NC(=O)c1cc(I)cc(I)c1Oc1cc(I)c(O)c(I)c1 |
|---|
| InChI Key | KKDMOZZLTBNZKY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | diphenylethers |
|---|
| Direct Parent | diphenylethers |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 3-halobenzoic acids and derivativesaryl iodidesbenzamidesbenzoyl derivativescarboxylic acids and derivativesdiarylethershalophenolshydrocarbon derivativesiodobenzeneso-iodophenolsorganic oxidesorganoiodidesorganonitrogen compoundsorganopnictogen compoundsphenol ethersphenoxy compoundsprimary carboxylic acid amides |
|---|
| Substituents | primary carboxylic acid amidediaryl etherphenol etherether3-halobenzoic acid or derivativesbenzoylcarboxylic acid derivativeorganohalogen compoundiodobenzenebenzamideorganoiodideorganic oxideorganonitrogen compoundorganopnictogen compound2-iodophenolbenzoic acid or derivativeshalobenzoic acid or derivativescarboxamide grouparyl halidearomatic homomonocyclic compound2-halophenolorganic oxygen compoundphenolhydrocarbon derivativearyl iodideorganic nitrogen compoundhalobenzenephenoxy compounddiphenyletherorganooxygen compound |
|---|