| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:50 UTC |
|---|
| Update Date | 2025-03-25 00:46:04 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02153071 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H11N5O2 |
|---|
| Molecular Mass | 245.0913 |
|---|
| SMILES | NC(=O)c1c(N)ncnc1Nc1ccc(O)cc1 |
|---|
| InChI Key | IWDRMVYPULPKMW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidinecarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsamino acids and derivativesazacyclic compoundsbenzene and substituted derivativescarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic oxidesorganooxygen compoundsorganopnictogen compoundsprimary aminesprimary carboxylic acid amidessecondary aminesvinylogous amides |
|---|
| Substituents | primary carboxylic acid amidemonocyclic benzene moietyaromatic heteromonocyclic compoundamino acid or derivatives1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundimidolactamvinylogous amideazacycleheteroaromatic compoundpyrimidine-5-carboxylic acid or derivativessecondary aminecarboxamide grouporganic oxygen compoundphenolhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundamineorganooxygen compound |
|---|
