| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:52 UTC |
|---|
| Update Date | 2025-03-25 00:46:05 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02153150 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H18N2O11P2 |
|---|
| Molecular Mass | 416.0386 |
|---|
| SMILES | NC(=O)C1=CN(C2OC(CO)C(COP(=O)(O)OP(=O)(O)O)O2)C=CC1 |
|---|
| InChI Key | FNGXJQPPEFKAQZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridines and derivatives |
|---|
| Subclass | pyridinecarboxylic acids and derivatives |
|---|
| Direct Parent | n-substituted nicotinamides |
|---|
| Geometric Descriptor | aliphatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,3-dioxolanesazacyclic compoundscarbonyl compoundscarboxylic acid amide acetalscarboxylic acids and derivativesdihydropyridinesenamineshydrocarbon derivativesmonoalkyl phosphatesorganic oxidesorganic pyrophosphatesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsprimary alcoholsprimary carboxylic acid amidesvinylogous amides |
|---|
| Substituents | primary carboxylic acid amidemeta-dioxolanecarbonyl groupcarboxylic acid derivativeamide acetalorganic oxidealiphatic heteromonocyclic compoundorganonitrogen compoundorganopnictogen compounddihydropyridineorthocarboxylic acid derivativeprimary alcoholalcoholvinylogous amideazacyclecarboxamide grouporganic pyrophosphaten-substituted nicotinamideoxacycleorganic oxygen compoundphosphoric acid estermonoalkyl phosphatehydrocarbon derivativeorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphateorganooxygen compoundenamine |
|---|
