| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:56 UTC |
|---|
| Update Date | 2025-03-25 00:46:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02153311 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H19NO3 |
|---|
| Molecular Mass | 297.1365 |
|---|
| SMILES | COc1ccc2c(c1)-c1cc(O)c(O)c3c1C(C2)N(C)CC3 |
|---|
| InChI Key | XCXMHFJZERKTBJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | alkaloids and derivatives |
|---|
| Class | aporphines |
|---|
| Subclass | aporphines |
|---|
| Direct Parent | aporphines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersanisolesaralkylaminesazacyclic compoundsbenzoquinolineshydrocarbon derivativesnaphthols and derivativesorganopnictogen compoundsphenanthrenes and derivativestetrahydroisoquinolinestrialkylamines |
|---|
| Substituents | phenol etherether1-hydroxy-2-unsubstituted benzenoidalkyl aryl etheraralkylaminearomatic heteropolycyclic compoundorganonitrogen compoundtetrahydroisoquinolinequinolineorganopnictogen compound2-naphtholtertiary amineorganoheterocyclic compoundphenanthreneazacycletertiary aliphatic aminebenzoquinolinenaphthaleneorganic oxygen compoundanisolehydrocarbon derivativebenzenoidorganic nitrogen compoundamineaporphineorganooxygen compound |
|---|