| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:57 UTC |
|---|
| Update Date | 2025-03-25 00:46:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02153359 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H27N3O4 |
|---|
| Molecular Mass | 337.2002 |
|---|
| SMILES | COc1ccc(NC(=O)CN2CCN(CCOCCO)CC2)cc1 |
|---|
| InChI Key | IWBVOXVJPNWXJM-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acid amides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | alcohols and polyolsalkyl aryl ethersalpha amino acidsanilidesanisolesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdialkyl ethershydrocarbon derivativesmethoxybenzenesn-alkylpiperazinesn-arylamidesn-piperazineacetamidesorganic oxidesorganopnictogen compoundsphenoxy compoundssecondary carboxylic acid amidestrialkylamines |
|---|
| Substituents | n-piperazineacetamidephenol ethermonocyclic benzene moietycarbonyl groupetheraromatic heteromonocyclic compoundn-arylamidealkyl aryl etherdialkyl etherorganic oxidepiperazineorganonitrogen compoundalpha-amino acidorganopnictogen compoundtertiary amineorganoheterocyclic compoundalcoholalpha-amino acid amideazacyclen-alkylpiperazinetertiary aliphatic aminecarboxamide groupmethoxybenzeneanilidesecondary carboxylic acid amideorganic oxygen compoundanisole1,4-diazinanehydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compoundamineorganooxygen compound |
|---|