| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:57 UTC |
|---|
| Update Date | 2025-03-25 00:46:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02153368 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H17NO3S |
|---|
| Molecular Mass | 267.0929 |
|---|
| SMILES | COc1ccc(NC(=O)CSCCC(C)=O)cc1 |
|---|
| InChI Key | RZBHAKHDNNGNKD-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | anilides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolescarboxylic acids and derivativesdialkylthioethershydrocarbon derivativesketonesmethoxybenzenesn-arylamidesorganic oxidesorganopnictogen compoundsphenoxy compoundssecondary carboxylic acid amidessulfenyl compounds |
|---|
| Substituents | phenol ethercarbonyl groupethern-arylamidealkyl aryl etherorganosulfur compoundcarboxylic acid derivativeketoneorganic oxideorganonitrogen compoundorganopnictogen compoundsulfenyl compounddialkylthioethercarboxamide groupmethoxybenzenearomatic homomonocyclic compoundanilidesecondary carboxylic acid amideorganic oxygen compoundthioetheranisolehydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
