| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:57 UTC |
|---|
| Update Date | 2025-03-25 00:46:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02153389 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H10O5S |
|---|
| Molecular Mass | 218.0249 |
|---|
| SMILES | COc1ccc(O)c(S(=O)(=O)OC)c1 |
|---|
| InChI Key | OVYIUKPIBOYCRR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonic acids and derivatives |
|---|
| Direct Parent | benzenesulfonate esters |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids4-alkoxyphenolsalkyl aryl ethersanisolesarylsulfonic acids and derivativesbenzenesulfonyl compoundshydrocarbon derivativesmethoxybenzenesmethoxyphenolsorganic oxidesorganosulfonic acid estersphenoxy compoundssulfonyls |
|---|
| Substituents | phenol etherorganosulfonic acid or derivativesbenzenesulfonate esterethermethoxyphenol1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherorganosulfur compoundorganic oxidebenzenesulfonyl group4-alkoxyphenolmethoxybenzeneorganosulfonic acid esteraromatic homomonocyclic compoundsulfonylorganic oxygen compoundarylsulfonic acid or derivativesorganic sulfonic acid or derivativesanisolephenolhydrocarbon derivativephenoxy compoundorganooxygen compound |
|---|
