| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:58 UTC |
|---|
| Update Date | 2025-03-25 00:46:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02153412 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H18O3 |
|---|
| Molecular Mass | 270.1256 |
|---|
| SMILES | COc1ccc2c(c1)CCc1c-2ccc(OC)c1OC |
|---|
| InChI Key | NELUVLNDRHBNME-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrenes and derivatives |
|---|
| Direct Parent | phenanthrenes and derivatives |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisoleshydrocarbon derivativesnaphthalenes |
|---|
| Substituents | phenol etherphenanthreneethernaphthaleneorganic oxygen compoundanisolearomatic homopolycyclic compoundhydrocarbon derivativealkyl aryl etherorganooxygen compound |
|---|