| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:58 UTC |
|---|
| Update Date | 2025-03-25 00:46:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02153425 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H26N2O5 |
|---|
| Molecular Mass | 350.1842 |
|---|
| SMILES | COc1ccc2c(c1)c(CCN(C)C)cn2C1OC(CO)C(O)C1O |
|---|
| InChI Key | TWKFKDROGFGAID-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | nucleosides, nucleotides, and analogues |
|---|
| Class | indole ribonucleosides and ribonucleotides |
|---|
| Subclass | indole ribonucleosides and ribonucleotides |
|---|
| Direct Parent | indole ribonucleosides and ribonucleotides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkaloids and derivativesalkyl aryl ethersanisolesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesindolesmonosaccharidesn-alkylindolesorganopnictogen compoundsoxacyclic compoundsprimary alcoholssecondary alcoholssubstituted pyrrolestetrahydrofuranstrialkylamines |
|---|
| Substituents | phenol etherethern-alkylindoleindolemonosaccharidesubstituted pyrrole1-ribofuranosylindolealkyl aryl ethersaccharidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundprimary alcoholtertiary amineorganoheterocyclic compoundalcoholazacycletetrahydrofuranheteroaromatic compoundtertiary aliphatic amineindole or derivativesoxacyclealkaloid or derivativesorganic oxygen compoundanisolepyrrolesecondary alcoholhydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|