| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:38:59 UTC |
|---|
| Update Date | 2025-03-25 00:46:07 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02153436 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H11NO3 |
|---|
| Molecular Mass | 241.0739 |
|---|
| SMILES | COc1ccc2c(c1)cc(O)c1[nH]c(=O)ccc12 |
|---|
| InChI Key | ZTKCEQCZEUFUPE-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | quinolines and derivatives |
|---|
| Subclass | benzoquinolines |
|---|
| Direct Parent | benzo[f]quinolin-3-ones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids2-halopyridines8-hydroxyquinolinesalkyl aryl ethersanisolesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativeshydroquinolineshydroquinoloneshydroxypyridineslactamsmethylpyridinesnaphthols and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspolyhalopyridinespyridinones |
|---|
| Substituents | phenol etheretherlactampolyhalopyridine1-hydroxy-2-unsubstituted benzenoidbenzo[f]quinolin-3-onealkyl aryl etherorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compound2-halopyridine2-naphthol8-hydroxyquinolineazacycleheteroaromatic compoundhydroxypyridinedihydroquinolinemethylpyridinedihydroquinolonepyridinenaphthaleneorganic oxygen compoundanisolehydrocarbon derivativebenzenoidorganic nitrogen compoundpyridinoneorganooxygen compound |
|---|
