| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:00 UTC |
|---|
| Update Date | 2025-03-25 00:46:08 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02153474 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H25NO2 |
|---|
| Molecular Mass | 287.1885 |
|---|
| SMILES | COc1ccc2c(c1)C1C(O)CCCC13CCN(C)C3C2 |
|---|
| InChI Key | UMHJSYVRTFUVBK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrenes and derivatives |
|---|
| Direct Parent | phenanthrenes and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesazacyclic compoundsazaspirodecane derivativescyclic alcohols and derivativeshydrocarbon derivativesindolesn-alkylpyrrolidinesorganopnictogen compoundssecondary alcoholstetralinstrialkylamines |
|---|
| Substituents | tetralinphenol etheretherindolealkyl aryl etheraromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundpyrrolidinetertiary amineorganoheterocyclic compoundalcoholphenanthreneazacyclen-alkylpyrrolidinetertiary aliphatic amineindole or derivativescyclic alcoholazaspirodecaneorganic oxygen compoundanisolesecondary alcoholhydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|