| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:02 UTC |
|---|
| Update Date | 2025-03-25 00:46:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02153573 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H18O5 |
|---|
| Molecular Mass | 326.1154 |
|---|
| SMILES | COc1ccc(C2c3cc(O)ccc3C(O)C3COC(=O)C23)cc1 |
|---|
| InChI Key | IVDMHSGFCNIYMG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lignans, neolignans and related compounds |
|---|
| Class | lignan lactones |
|---|
| Subclass | lignan lactones |
|---|
| Direct Parent | lignan lactones |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersanisolesaryltetralin lignanscarbonyl compoundscarboxylic acid estersgamma butyrolactoneshydrocarbon derivativesmethoxybenzenesmonocarboxylic acids and derivativesnaphthofuransorganic oxidesoxacyclic compoundsphenoxy compoundssecondary alcoholstetrahydrofuranstetralins |
|---|
| Substituents | tetralinphenol ethermonocyclic benzene moietycarbonyl groupether1-hydroxy-2-unsubstituted benzenoid1-aryltetralin lignanalkyl aryl ethercarboxylic acid derivativelignan lactonelactoneorganic oxidearomatic heteropolycyclic compoundorganoheterocyclic compoundalcoholnaphthofurantetrahydrofuranmethoxybenzenegamma butyrolactoneoxacyclemonocarboxylic acid or derivativesorganic oxygen compoundanisolecarboxylic acid estersecondary alcoholhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compound |
|---|