| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 14:39:02 UTC |
|---|
| Update Date | 2025-03-25 00:46:09 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02153584 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H17NO2 |
|---|
| Molecular Mass | 255.1259 |
|---|
| SMILES | COc1ccc(CCC(=O)c2ccccc2N)cc1 |
|---|
| InChI Key | NYYOHXQQNMSMHH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | linear 1,3-diarylpropanoids |
|---|
| Subclass | chalcones and dihydrochalcones |
|---|
| Direct Parent | retro-dihydrochalcones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersalkyl-phenylketonesanisolesaryl alkyl ketonesbenzoyl derivativesbutyrophenoneshydrocarbon derivativeslinear 1,3-diarylpropanoidsmethoxybenzenesorganic oxidesorganopnictogen compoundsphenoxy compoundsprimary aminesvinylogous amides |
|---|
| Substituents | phenol ethermonocyclic benzene moietyetheraryl alkyl ketonebenzoylretro-dihydrochalconealkyl aryl etherketoneorganic oxideorganonitrogen compoundorganopnictogen compoundvinylogous amidemethoxybenzenephenylketonebutyrophenonearomatic homomonocyclic compoundorganic oxygen compoundanisolehydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundphenoxy compoundaminealkyl-phenylketoneorganooxygen compoundaryl ketone |
|---|
